C31H38N2O4 — CID 25056996
(E)-1-[(1S,2S,17S)-18-(cyclopropylmethyl)-2,12-dihydroxy-7-methyl-10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaen-6-yl]oct-1-en-3-one (PubChem CID 25056996) has the molecular formula C31H38N2O4 and a molecular weight of 502.66 g/mol. Its IUPAC name is (E)-1-[(1S,2S,17S)-18-(cyclopropylmethyl)-2,12-dihydroxy-7-methyl-10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaen-6-yl]oct-1-en-3-one.
| Compound Name | (E)-1-[(1S,2S,17S)-18-(cyclopropylmethyl)-2,12-dihydroxy-7-methyl-10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaen-6-yl]oct-1-en-3-one |
|---|---|
| PubChem CID | 25056996 |
| Molecular Formula | C31H38N2O4 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | (E)-1-[(1S,2S,17S)-18-(cyclopropylmethyl)-2,12-dihydroxy-7-methyl-10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaen-6-yl]oct-1-en-3-one |
| SMILES | CCCCCC(=O)/C=C/c1cc2c(n1C)C1Oc3c(O)ccc4c3[C@@]13CCN(CC1CC1)[C@@H](C4)[C@]3(O)C2 |
| InChI | InChI=1S/C31H38N2O4/c1-3-4-5-6-23(34)11-10-22-15-21-17-31(36)25-16-20-9-12-24(35)28-26(20)30(31,29(37-28)27(21)32(22)2)13-14-33(25)18-19-7-8-19/h9-12,15,19,25,29,35-36H,3-8,13-14,16-18H2,1-2H3/b11-10+/t25-,29?,30-,31+/m0/s1 |
| InChIKey | IDIQHUHLWUXDIK-IPDNBRQMSA-N |
| XLogP | 4.59 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|