C38H58N2O4 — CID 14845817
(E)-N-[(4R,4aS,7S,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]octadec-9-enamide (PubChem CID 14845817) has the molecular formula C38H58N2O4 and a molecular weight of 606.89 g/mol. Its IUPAC name is (E)-N-[(4R,4aS,7S,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]octadec-9-enamide.
| Compound Name | (E)-N-[(4R,4aS,7S,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 14845817 |
| Molecular Formula | C38H58N2O4 |
| Molecular Weight | 606.89 g/mol |
| Exact Mass | 606.44 |
| IUPAC Name | (E)-N-[(4R,4aS,7S,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)N[C@H]1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C38H58N2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-33(42)39-30-22-23-38(43)32-26-29-20-21-31(41)35-34(29)37(38,36(30)44-35)24-25-40(32)27-28-18-19-28/h9-10,20-21,28,30,32,36,41,43H,2-8,11-19,22-27H2,1H3,(H,39,42)/b10-9+/t30-,32+,36-,37-,38+/m0/s1 |
| InChIKey | OTCSJLJCIKPFHU-KGJXWXEFSA-N |
| XLogP | 7.48 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.89 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|