C27H32N2O4S — CID 166625602
N-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-thiophen-3-ylpropanamide (PubChem CID 166625602) has the molecular formula C27H32N2O4S and a molecular weight of 480.63 g/mol. Its IUPAC name is N-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-thiophen-3-ylpropanamide.
| Compound Name | N-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 166625602 |
| Molecular Formula | C27H32N2O4S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | N-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-thiophen-3-ylpropanamide |
| SMILES | O=C(CCc1ccsc1)N[C@@H]1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C27H32N2O4S/c30-20-5-4-18-13-21-27(32)9-7-19(28-22(31)6-3-17-8-12-34-15-17)25-26(27,23(18)24(20)33-25)10-11-29(21)14-16-1-2-16/h4-5,8,12,15-16,19,21,25,30,32H,1-3,6-7,9-11,13-14H2,(H,28,31)/t19-,21-,25+,26+,27-/m1/s1 |
| InChIKey | OQAOEJBHRKQDKI-VRNWNKBTSA-N |
| XLogP | 3.14 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |