C31H32N2O4 — CID 42608550
(E)-1-[(1S,2S,9R,17R)-2,12-dihydroxy-7,18-dimethyl-10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaen-6-yl]-5-phenylpent-1-en-3-one (PubChem CID 42608550) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is (E)-1-[(1S,2S,9R,17R)-2,12-dihydroxy-7,18-dimethyl-10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaen-6-yl]-5-phenylpent-1-en-3-one.
| Compound Name | (E)-1-[(1S,2S,9R,17R)-2,12-dihydroxy-7,18-dimethyl-10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaen-6-yl]-5-phenylpent-1-en-3-one |
|---|---|
| PubChem CID | 42608550 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | (E)-1-[(1S,2S,9R,17R)-2,12-dihydroxy-7,18-dimethyl-10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaen-6-yl]-5-phenylpent-1-en-3-one |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2c2c(cc(/C=C/C(=O)CCc4ccccc4)n2C)C[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C31H32N2O4/c1-32-15-14-30-26-20-9-13-24(35)28(26)37-29(30)27-21(18-31(30,36)25(32)17-20)16-22(33(27)2)10-12-23(34)11-8-19-6-4-3-5-7-19/h3-7,9-10,12-13,16,25,29,35-36H,8,11,14-15,17-18H2,1-2H3/b12-10+/t25-,29+,30+,31-/m1/s1 |
| InChIKey | DJFMNISYWFKWJK-APKKWQIUSA-N |
| XLogP | 3.86 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|