C28H32N2O4 — CID 70218345
N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-(3-methylphenyl)propanamide (PubChem CID 70218345) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-(3-methylphenyl)propanamide.
| Compound Name | N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 70218345 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(CCC(=O)N(C)C2C=C[C@@]3(O)[C@H]4Cc5ccc(O)c6c5[C@@]3(CCN4C)C2O6)c1 |
| InChI | InChI=1S/C28H32N2O4/c1-17-5-4-6-18(15-17)7-10-23(32)30(3)20-11-12-28(33)22-16-19-8-9-21(31)25-24(19)27(28,26(20)34-25)13-14-29(22)2/h4-6,8-9,11-12,15,20,22,26,31,33H,7,10,13-14,16H2,1-3H3/t20?,22-,26?,27+,28-/m1/s1 |
| InChIKey | OADJPKCIMDGHRD-DVHYCDKQSA-N |
| XLogP | 2.72 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|