C30H38N2O4 — CID 70218340
N-[(4R,4aS,12bS)-4a,9-dihydroxy-3,6-dimethyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3,4-dimethylphenyl)-N-methylpropanamide (PubChem CID 70218340) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is N-[(4R,4aS,12bS)-4a,9-dihydroxy-3,6-dimethyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3,4-dimethylphenyl)-N-methylpropanamide.
| Compound Name | N-[(4R,4aS,12bS)-4a,9-dihydroxy-3,6-dimethyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3,4-dimethylphenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 70218340 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | N-[(4R,4aS,12bS)-4a,9-dihydroxy-3,6-dimethyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3,4-dimethylphenyl)-N-methylpropanamide |
| SMILES | Cc1ccc(CCC(=O)N(C)C2C(C)C[C@@]3(O)[C@H]4Cc5ccc(O)c6c5[C@@]3(CCN4C)C2O6)cc1C |
| InChI | InChI=1S/C30H38N2O4/c1-17-6-7-20(14-18(17)2)8-11-24(34)32(5)26-19(3)16-30(35)23-15-21-9-10-22(33)27-25(21)29(30,28(26)36-27)12-13-31(23)4/h6-7,9-10,14,19,23,26,28,33,35H,8,11-13,15-16H2,1-5H3/t19?,23-,26?,28?,29+,30-/m1/s1 |
| InChIKey | JJGGFWWJIOZMGD-DSISBRCMSA-N |
| XLogP | 3.50 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |