C30H32N2O3 — CID 142176396
(4R,4aS,7R,7aR,12bS)-7-(N-benzylanilino)-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 142176396) has the molecular formula C30H32N2O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is (4R,4aS,7R,7aR,12bS)-7-(N-benzylanilino)-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,7R,7aR,12bS)-7-(N-benzylanilino)-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 142176396 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | (4R,4aS,7R,7aR,12bS)-7-(N-benzylanilino)-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@H](N(Cc2ccccc2)c2ccccc2)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C30H32N2O3/c1-31-17-16-29-26-21-12-13-24(33)27(26)35-28(29)23(14-15-30(29,34)25(31)18-21)32(22-10-6-3-7-11-22)19-20-8-4-2-5-9-20/h2-13,23,25,28,33-34H,14-19H2,1H3/t23-,25-,28+,29+,30-/m1/s1 |
| InChIKey | HIIJESMEAQOPEB-CTVNGGNQSA-N |
| XLogP | 4.25 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |