C36H50N2O3 — CID 70264697
(4R,4aS,7S,7aR,12bS)-7-[butyl(6-phenylhexyl)amino]-3-(cyclopropylmethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 70264697) has the molecular formula C36H50N2O3 and a molecular weight of 558.81 g/mol. Its IUPAC name is (4R,4aS,7S,7aR,12bS)-7-[butyl(6-phenylhexyl)amino]-3-(cyclopropylmethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,7S,7aR,12bS)-7-[butyl(6-phenylhexyl)amino]-3-(cyclopropylmethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 70264697 |
| Molecular Formula | C36H50N2O3 |
| Molecular Weight | 558.81 g/mol |
| Exact Mass | 558.38 |
| IUPAC Name | (4R,4aS,7S,7aR,12bS)-7-[butyl(6-phenylhexyl)amino]-3-(cyclopropylmethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | CCCCN(CCCCCCc1ccccc1)[C@H]1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C36H50N2O3/c1-2-3-21-37(22-10-5-4-7-11-26-12-8-6-9-13-26)29-18-19-36(40)31-24-28-16-17-30(39)33-32(28)35(36,34(29)41-33)20-23-38(31)25-27-14-15-27/h6,8-9,12-13,16-17,27,29,31,34,39-40H,2-5,7,10-11,14-15,18-25H2,1H3/t29-,31+,34-,35-,36+/m0/s1 |
| InChIKey | MVWRSEZXWZUAHP-BLGMLHPASA-N |
| XLogP | 6.23 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.81 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|