C42H50N2O5 — CID 70264816
[(4R,4aS,7S,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-[phenacyl(6-phenylhexyl)amino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 70264816) has the molecular formula C42H50N2O5 and a molecular weight of 662.87 g/mol. Its IUPAC name is [(4R,4aS,7S,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-[phenacyl(6-phenylhexyl)amino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aS,7S,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-[phenacyl(6-phenylhexyl)amino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 70264816 |
| Molecular Formula | C42H50N2O5 |
| Molecular Weight | 662.87 g/mol |
| Exact Mass | 662.37 |
| IUPAC Name | [(4R,4aS,7S,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-[phenacyl(6-phenylhexyl)amino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c3c1O[C@H]1[C@@H](N(CCCCCCc4ccccc4)CC(=O)c4ccccc4)CC[C@@]4(O)[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C42H50N2O5/c1-29(45)48-36-20-19-33-26-37-42(47)22-21-34(40-41(42,38(33)39(36)49-40)23-25-44(37)27-31-17-18-31)43(28-35(46)32-15-9-5-10-16-32)24-11-3-2-6-12-30-13-7-4-8-14-30/h4-5,7-10,13-16,19-20,31,34,37,40,47H,2-3,6,11-12,17-18,21-28H2,1H3/t34-,37+,40-,41-,42+/m0/s1 |
| InChIKey | CNJNIMCNDKZBHN-JNVMGPBQSA-N |
| XLogP | 6.53 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.87 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|