C42H54N2O3 — CID 70268100
(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-7-[4-phenylbutyl(6-phenylhexyl)amino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 70268100) has the molecular formula C42H54N2O3 and a molecular weight of 634.91 g/mol. Its IUPAC name is (4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-7-[4-phenylbutyl(6-phenylhexyl)amino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-7-[4-phenylbutyl(6-phenylhexyl)amino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 70268100 |
| Molecular Formula | C42H54N2O3 |
| Molecular Weight | 634.91 g/mol |
| Exact Mass | 634.41 |
| IUPAC Name | (4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-7-[4-phenylbutyl(6-phenylhexyl)amino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | Oc1ccc2c3c1O[C@H]1[C@H](N(CCCCCCc4ccccc4)CCCCc4ccccc4)CC[C@@]4(O)[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C42H54N2O3/c45-36-22-21-34-29-37-42(46)24-23-35(40-41(42,38(34)39(36)47-40)25-28-44(37)30-33-19-20-33)43(27-12-10-18-32-16-8-4-9-17-32)26-11-2-1-5-13-31-14-6-3-7-15-31/h3-4,6-9,14-17,21-22,33,35,37,40,45-46H,1-2,5,10-13,18-20,23-30H2/t35-,37-,40+,41+,42-/m1/s1 |
| InChIKey | PDILHWPMEUCADK-JDRPTWPRSA-N |
| XLogP | 7.45 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.91 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|