C45H52N2O3 — CID 70268526
(4R,4aS,7S,7aR,12bS)-7-[2,2-diphenylethyl(6-phenylhexyl)amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 70268526) has the molecular formula C45H52N2O3 and a molecular weight of 668.92 g/mol. Its IUPAC name is (4R,4aS,7S,7aR,12bS)-7-[2,2-diphenylethyl(6-phenylhexyl)amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,7S,7aR,12bS)-7-[2,2-diphenylethyl(6-phenylhexyl)amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 70268526 |
| Molecular Formula | C45H52N2O3 |
| Molecular Weight | 668.92 g/mol |
| Exact Mass | 668.40 |
| IUPAC Name | (4R,4aS,7S,7aR,12bS)-7-[2,2-diphenylethyl(6-phenylhexyl)amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](N(CCCCCCc2ccccc2)CC(c2ccccc2)c2ccccc2)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C45H52N2O3/c1-2-28-46-30-27-44-41-36-23-24-39(48)42(41)50-43(44)38(25-26-45(44,49)40(46)31-36)47(29-15-4-3-8-16-33-17-9-5-10-18-33)32-37(34-19-11-6-12-20-34)35-21-13-7-14-22-35/h2,5-7,9-14,17-24,37-38,40,43,48-49H,1,3-4,8,15-16,25-32H2/t38-,40+,43-,44-,45+/m0/s1 |
| InChIKey | VQUCYYVVEAYHPZ-DBSOTAGCSA-N |
| XLogP | 8.04 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.92 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|