C37H52N2O3 — CID 70267990
(4R,4aS,7R,7aR,12bS)-9-methoxy-7-[pentyl(6-phenylhexyl)amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol (PubChem CID 70267990) has the molecular formula C37H52N2O3 and a molecular weight of 572.83 g/mol. Its IUPAC name is (4R,4aS,7R,7aR,12bS)-9-methoxy-7-[pentyl(6-phenylhexyl)amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol.
| Compound Name | (4R,4aS,7R,7aR,12bS)-9-methoxy-7-[pentyl(6-phenylhexyl)amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
|---|---|
| PubChem CID | 70267990 |
| Molecular Formula | C37H52N2O3 |
| Molecular Weight | 572.83 g/mol |
| Exact Mass | 572.40 |
| IUPAC Name | (4R,4aS,7R,7aR,12bS)-9-methoxy-7-[pentyl(6-phenylhexyl)amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
| SMILES | C=CCN1CC[C@]23c4c5ccc(OC)c4O[C@H]2[C@H](N(CCCCC)CCCCCCc2ccccc2)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C37H52N2O3/c1-4-6-13-24-38(25-14-8-7-10-15-28-16-11-9-12-17-28)30-20-21-37(40)32-27-29-18-19-31(41-3)34-33(29)36(37,35(30)42-34)22-26-39(32)23-5-2/h5,9,11-12,16-19,30,32,35,40H,2,4,6-8,10,13-15,20-27H2,1,3H3/t30-,32-,35+,36+,37-/m1/s1 |
| InChIKey | NUTWRTLESFUYOV-GAFAXQLVSA-N |
| XLogP | 6.70 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.83 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|