C40H50N2O3 — CID 70266857
(4R,4aS,12bS)-9-methoxy-7-[[6-phenyl-2-(2-phenylethyl)hexyl]amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol (PubChem CID 70266857) has the molecular formula C40H50N2O3 and a molecular weight of 606.85 g/mol. Its IUPAC name is (4R,4aS,12bS)-9-methoxy-7-[[6-phenyl-2-(2-phenylethyl)hexyl]amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol.
| Compound Name | (4R,4aS,12bS)-9-methoxy-7-[[6-phenyl-2-(2-phenylethyl)hexyl]amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
|---|---|
| PubChem CID | 70266857 |
| Molecular Formula | C40H50N2O3 |
| Molecular Weight | 606.85 g/mol |
| Exact Mass | 606.38 |
| IUPAC Name | (4R,4aS,12bS)-9-methoxy-7-[[6-phenyl-2-(2-phenylethyl)hexyl]amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
| SMILES | C=CCN1CC[C@]23c4c5ccc(OC)c4OC2C(NCC(CCCCc2ccccc2)CCc2ccccc2)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C40H50N2O3/c1-3-25-42-26-24-39-36-32-20-21-34(44-2)37(36)45-38(39)33(22-23-40(39,43)35(42)27-32)41-28-31(19-18-30-14-8-5-9-15-30)17-11-10-16-29-12-6-4-7-13-29/h3-9,12-15,20-21,31,33,35,38,41,43H,1,10-11,16-19,22-28H2,2H3/t31?,33?,35-,38?,39+,40-/m1/s1 |
| InChIKey | ZTLRDGQFIBGHNP-QBSUCRFRSA-N |
| XLogP | 6.66 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.85 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|