C43H54N2O4 — CID 70266987
[(4R,4aS,12bS)-4a-hydroxy-7-[4-phenylbutyl(6-phenylhexyl)amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 70266987) has the molecular formula C43H54N2O4 and a molecular weight of 662.92 g/mol. Its IUPAC name is [(4R,4aS,12bS)-4a-hydroxy-7-[4-phenylbutyl(6-phenylhexyl)amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aS,12bS)-4a-hydroxy-7-[4-phenylbutyl(6-phenylhexyl)amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 70266987 |
| Molecular Formula | C43H54N2O4 |
| Molecular Weight | 662.92 g/mol |
| Exact Mass | 662.41 |
| IUPAC Name | [(4R,4aS,12bS)-4a-hydroxy-7-[4-phenylbutyl(6-phenylhexyl)amino]-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | C=CCN1CC[C@]23c4c5ccc(OC(C)=O)c4OC2C(N(CCCCCCc2ccccc2)CCCCc2ccccc2)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C43H54N2O4/c1-3-27-45-30-26-42-39-35-22-23-37(48-32(2)46)40(39)49-41(42)36(24-25-43(42,47)38(45)31-35)44(29-15-13-21-34-19-11-7-12-20-34)28-14-5-4-8-16-33-17-9-6-10-18-33/h3,6-7,9-12,17-20,22-23,36,38,41,47H,1,4-5,8,13-16,21,24-31H2,2H3/t36?,38-,41?,42+,43-/m1/s1 |
| InChIKey | AXXUXRYMDOSOAM-MHCJYONGSA-N |
| XLogP | 7.45 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.92 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|