C33H36N2O4 — CID 10301794
[(4R,4aS,7aR,12bS)-4a-hydroxy-7-(N-methylanilino)-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 10301794) has the molecular formula C33H36N2O4 and a molecular weight of 524.66 g/mol. Its IUPAC name is [(4R,4aS,7aR,12bS)-4a-hydroxy-7-(N-methylanilino)-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aS,7aR,12bS)-4a-hydroxy-7-(N-methylanilino)-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 10301794 |
| Molecular Formula | C33H36N2O4 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | [(4R,4aS,7aR,12bS)-4a-hydroxy-7-(N-methylanilino)-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c3c1O[C@H]1C(N(C)c4ccccc4)CC[C@@]4(O)[C@@H](C2)N(CCc2ccccc2)CC[C@]314 |
| InChI | InChI=1S/C33H36N2O4/c1-22(36)38-27-14-13-24-21-28-33(37)17-15-26(34(2)25-11-7-4-8-12-25)31-32(33,29(24)30(27)39-31)18-20-35(28)19-16-23-9-5-3-6-10-23/h3-14,26,28,31,37H,15-21H2,1-2H3/t26?,28-,31+,32+,33-/m1/s1 |
| InChIKey | QSMOMWLEWPQDRD-UYPOEZLGSA-N |
| XLogP | 4.51 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|