C30H32Cl2N2O5 — CID 70219876
[(4R,4aS,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-4a-hydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 70219876) has the molecular formula C30H32Cl2N2O5 and a molecular weight of 571.50 g/mol. Its IUPAC name is [(4R,4aS,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-4a-hydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aS,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-4a-hydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 70219876 |
| Molecular Formula | C30H32Cl2N2O5 |
| Molecular Weight | 571.50 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | [(4R,4aS,12bS)-7-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-4a-hydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | C=CCN1CC[C@]23c4c5ccc(OC(C)=O)c4OC2C(N(C)C(=O)Cc2ccc(Cl)c(Cl)c2)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C30H32Cl2N2O5/c1-4-12-34-13-11-29-26-19-6-8-23(38-17(2)35)27(26)39-28(29)22(9-10-30(29,37)24(34)16-19)33(3)25(36)15-18-5-7-20(31)21(32)14-18/h4-8,14,22,24,28,37H,1,9-13,15-16H2,2-3H3/t22?,24-,28?,29+,30-/m1/s1 |
| InChIKey | PFMNHKBHJZJJNY-GIKFTBDXSA-N |
| XLogP | 4.33 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|