C28H29Cl3N2O5 — CID 70219532
N-[(4R,4aS,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 70219532) has the molecular formula C28H29Cl3N2O5 and a molecular weight of 579.91 g/mol. Its IUPAC name is N-[(4R,4aS,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(4R,4aS,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 70219532 |
| Molecular Formula | C28H29Cl3N2O5 |
| Molecular Weight | 579.91 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | N-[(4R,4aS,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@H](N(C)C(=O)COc2cc(Cl)c(Cl)cc2Cl)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C28H29Cl3N2O5/c1-3-9-33-10-8-27-24-15-4-5-20(34)25(24)38-26(27)19(6-7-28(27,36)22(33)11-15)32(2)23(35)14-37-21-13-17(30)16(29)12-18(21)31/h3-5,12-13,19,22,26,34,36H,1,6-11,14H2,2H3/t19-,22-,26+,27+,28-/m1/s1 |
| InChIKey | PHQBOKCMLIZERZ-YPDVEHGRSA-N |
| XLogP | 4.60 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.91 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|