C30H33F3N2O4 — CID 70220429
N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 70220429) has the molecular formula C30H33F3N2O4 and a molecular weight of 542.60 g/mol. Its IUPAC name is N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 70220429 |
| Molecular Formula | C30H33F3N2O4 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4OC2C(N(C)C(=O)CCc2cccc(C(F)(F)F)c2)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C30H33F3N2O4/c1-3-14-35-15-13-28-25-19-8-9-22(36)26(25)39-27(28)21(11-12-29(28,38)23(35)17-19)34(2)24(37)10-7-18-5-4-6-20(16-18)30(31,32)33/h3-6,8-9,16,21,23,27,36,38H,1,7,10-15,17H2,2H3/t21?,23-,27?,28+,29-/m1/s1 |
| InChIKey | RSHSYOVKVPDTBT-VPHHNSJXSA-N |
| XLogP | 4.21 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|