C28H30F2N2O4 — CID 70220115
N-[(4R,4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-2-(3,4-difluorophenyl)-N-methylacetamide (PubChem CID 70220115) has the molecular formula C28H30F2N2O4 and a molecular weight of 496.55 g/mol. Its IUPAC name is N-[(4R,4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-2-(3,4-difluorophenyl)-N-methylacetamide.
| Compound Name | N-[(4R,4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-2-(3,4-difluorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 70220115 |
| Molecular Formula | C28H30F2N2O4 |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | N-[(4R,4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-2-(3,4-difluorophenyl)-N-methylacetamide |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](N(C)C(=O)Cc2ccc(F)c(F)c2)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C28H30F2N2O4/c1-3-11-32-12-10-27-24-17-5-7-21(33)25(24)36-26(27)20(8-9-28(27,35)22(32)15-17)31(2)23(34)14-16-4-6-18(29)19(30)13-16/h3-7,13,20,22,26,33,35H,1,8-12,14-15H2,2H3/t20-,22+,26-,27-,28+/m0/s1 |
| InChIKey | WESJRBMYHFDPFU-MENBUCELSA-N |
| XLogP | 3.08 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|