C27H29BrN2O4S — CID 70221160
(E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide (PubChem CID 70221160) has the molecular formula C27H29BrN2O4S and a molecular weight of 557.51 g/mol. Its IUPAC name is (E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 70221160 |
| Molecular Formula | C27H29BrN2O4S |
| Molecular Weight | 557.51 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | (E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4OC2C(N(C)C(=O)/C=C/c2cc(Br)cs2)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C27H29BrN2O4S/c1-3-11-30-12-10-26-23-16-4-6-20(31)24(23)34-25(26)19(8-9-27(26,33)21(30)13-16)29(2)22(32)7-5-18-14-17(28)15-35-18/h3-7,14-15,19,21,25,31,33H,1,8-13H2,2H3/b7-5+/t19?,21-,25?,26+,27-/m1/s1 |
| InChIKey | JOLBZXIRGHCBQX-KZFCCKSLSA-N |
| XLogP | 4.10 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|