C27H27BrN2O5S — CID 70221004
(E)-N-[(4S,4aS,12bS)-4a,9-dihydroxy-13-oxo-3-prop-2-enyl-2,4,5,6,7,7a-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide (PubChem CID 70221004) has the molecular formula C27H27BrN2O5S and a molecular weight of 571.49 g/mol. Its IUPAC name is (E)-N-[(4S,4aS,12bS)-4a,9-dihydroxy-13-oxo-3-prop-2-enyl-2,4,5,6,7,7a-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[(4S,4aS,12bS)-4a,9-dihydroxy-13-oxo-3-prop-2-enyl-2,4,5,6,7,7a-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 70221004 |
| Molecular Formula | C27H27BrN2O5S |
| Molecular Weight | 571.49 g/mol |
| Exact Mass | 570.08 |
| IUPAC Name | (E)-N-[(4S,4aS,12bS)-4a,9-dihydroxy-13-oxo-3-prop-2-enyl-2,4,5,6,7,7a-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4OC2C(N(C)C(=O)/C=C/c2cc(Br)cs2)CC[C@@]3(O)[C@H]1C5=O |
| InChI | InChI=1S/C27H27BrN2O5S/c1-3-11-30-12-10-26-21-17-5-6-19(31)23(21)35-25(26)18(8-9-27(26,34)24(30)22(17)33)29(2)20(32)7-4-16-13-15(28)14-36-16/h3-7,13-14,18,24-25,31,34H,1,8-12H2,2H3/b7-4+/t18?,24-,25?,26+,27-/m1/s1 |
| InChIKey | KLGPTKQNQTZONB-NUOPDLCJSA-N |
| XLogP | 3.74 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|