C26H29BrN2O4S — CID 70221865
(E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3,5-dimethyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide (PubChem CID 70221865) has the molecular formula C26H29BrN2O4S and a molecular weight of 545.50 g/mol. Its IUPAC name is (E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3,5-dimethyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3,5-dimethyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 70221865 |
| Molecular Formula | C26H29BrN2O4S |
| Molecular Weight | 545.50 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | (E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3,5-dimethyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(4-bromothiophen-2-yl)-N-methylprop-2-enamide |
| SMILES | CC1CC(N(C)C(=O)/C=C/c2cc(Br)cs2)C2Oc3c(O)ccc4c3[C@@]23CCN(C)[C@H](C4)[C@]13O |
| InChI | InChI=1S/C26H29BrN2O4S/c1-14-10-18(29(3)21(31)7-5-17-12-16(27)13-34-17)24-25-8-9-28(2)20(26(14,25)32)11-15-4-6-19(30)23(33-24)22(15)25/h4-7,12-14,18,20,24,30,32H,8-11H2,1-3H3/b7-5+/t14?,18?,20-,24?,25+,26-/m1/s1 |
| InChIKey | HRHCLVNNJUINPG-FUJJVKQJSA-N |
| XLogP | 3.79 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|