C28H32N2O4 — CID 70219825
(E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]-N-methyl-3-(3-methylphenyl)prop-2-enamide (PubChem CID 70219825) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is (E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]-N-methyl-3-(3-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]-N-methyl-3-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 70219825 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | (E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]-N-methyl-3-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(/C=C/C(=O)N(C)C2CC3Oc4c(O)ccc5c4[C@@]34CCN(C)[C@H](C5)[C@]4(O)C2)c1 |
| InChI | InChI=1S/C28H32N2O4/c1-17-5-4-6-18(13-17)7-10-24(32)30(3)20-15-23-27-11-12-29(2)22(28(27,33)16-20)14-19-8-9-21(31)26(34-23)25(19)27/h4-10,13,20,22-23,31,33H,11-12,14-16H2,1-3H3/b10-7+/t20?,22-,23?,27-,28-/m1/s1 |
| InChIKey | UXGZAPHFOYSMBZ-MXYDINEJSA-N |
| XLogP | 3.02 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|