C28H29F3N2O5 — CID 70217669
(E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-5-yl]-N-methyl-3-[3-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 70217669) has the molecular formula C28H29F3N2O5 and a molecular weight of 530.54 g/mol. Its IUPAC name is (E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-5-yl]-N-methyl-3-[3-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-5-yl]-N-methyl-3-[3-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70217669 |
| Molecular Formula | C28H29F3N2O5 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | (E)-N-[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-5-yl]-N-methyl-3-[3-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1cccc(OC(F)(F)F)c1)C1CCC2Oc3c(O)ccc4c3[C@@]23CCN(C)[C@H](C4)[C@]13O |
| InChI | InChI=1S/C28H29F3N2O5/c1-32-13-12-26-22-10-9-20(27(26,36)21(32)15-17-7-8-19(34)25(37-22)24(17)26)33(2)23(35)11-6-16-4-3-5-18(14-16)38-28(29,30)31/h3-8,11,14,20-22,34,36H,9-10,12-13,15H2,1-2H3/b11-6+/t20?,21-,22?,26-,27-/m1/s1 |
| InChIKey | WSWRQMJRNLLHSV-JXEGVCDCSA-N |
| XLogP | 3.62 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|