C34H42N2O4 — CID 54044052
N-[(4R,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3-methylphenyl)-N-(2-methylpropyl)prop-2-enamide (PubChem CID 54044052) has the molecular formula C34H42N2O4 and a molecular weight of 542.72 g/mol. Its IUPAC name is N-[(4R,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3-methylphenyl)-N-(2-methylpropyl)prop-2-enamide.
| Compound Name | N-[(4R,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3-methylphenyl)-N-(2-methylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 54044052 |
| Molecular Formula | C34H42N2O4 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | N-[(4R,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3-methylphenyl)-N-(2-methylpropyl)prop-2-enamide |
| SMILES | Cc1cccc(C=CC(=O)N(CC(C)C)C2CCC3(O)[C@H]4Cc5ccc(O)c6c5[C@@]3(CCN4CC3CC3)C2O6)c1 |
| InChI | InChI=1S/C34H42N2O4/c1-21(2)19-36(29(38)12-9-23-6-4-5-22(3)17-23)26-13-14-34(39)28-18-25-10-11-27(37)31-30(25)33(34,32(26)40-31)15-16-35(28)20-24-7-8-24/h4-6,9-12,17,21,24,26,28,32,37,39H,7-8,13-16,18-20H2,1-3H3/t26?,28-,32?,33+,34?/m1/s1 |
| InChIKey | LOHQVTIJAQYKOO-UFWPLTCRSA-N |
| XLogP | 4.83 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|