C33H40N2O4 — CID 57143976
N-[(4R,4aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-3-phenylprop-2-enamide (PubChem CID 57143976) has the molecular formula C33H40N2O4 and a molecular weight of 528.69 g/mol. Its IUPAC name is N-[(4R,4aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-3-phenylprop-2-enamide.
| Compound Name | N-[(4R,4aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 57143976 |
| Molecular Formula | C33H40N2O4 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | N-[(4R,4aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-3-phenylprop-2-enamide |
| SMILES | CC(C)CN(C(=O)C=Cc1ccccc1)C1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)C1O5 |
| InChI | InChI=1S/C33H40N2O4/c1-21(2)19-35(28(37)13-10-22-6-4-3-5-7-22)25-14-15-33(38)27-18-24-11-12-26(36)30-29(24)32(33,31(25)39-30)16-17-34(27)20-23-8-9-23/h3-7,10-13,21,23,25,27,31,36,38H,8-9,14-20H2,1-2H3/t25?,27-,31?,32+,33-/m1/s1 |
| InChIKey | NWPCFPFJBHNAHC-VWADHHNXSA-N |
| XLogP | 4.52 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|