C35H52N2O4 — CID 90767991
N-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-cyclohexyl-N-(2-methylpropyl)pentanamide (PubChem CID 90767991) has the molecular formula C35H52N2O4 and a molecular weight of 564.81 g/mol. Its IUPAC name is N-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-cyclohexyl-N-(2-methylpropyl)pentanamide.
| Compound Name | N-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-cyclohexyl-N-(2-methylpropyl)pentanamide |
|---|---|
| PubChem CID | 90767991 |
| Molecular Formula | C35H52N2O4 |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.39 |
| IUPAC Name | N-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-cyclohexyl-N-(2-methylpropyl)pentanamide |
| SMILES | CC(C)CN(C(=O)CCCCC1CCCCC1)[C@@H]1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C35H52N2O4/c1-23(2)21-37(30(39)11-7-6-10-24-8-4-3-5-9-24)27-16-17-35(40)29-20-26-14-15-28(38)32-31(26)34(35,33(27)41-32)18-19-36(29)22-25-12-13-25/h14-15,23-25,27,29,33,38,40H,3-13,16-22H2,1-2H3/t27-,29-,33+,34+,35-/m1/s1 |
| InChIKey | GWFUPKDZTHWWJA-KMLMFMHOSA-N |
| XLogP | 5.95 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|