C24H34N2O3 — CID 15908861
(4R,4aS,7S,7aR,12bS)-3-(cyclopropylmethyl)-7-(2-methylpropylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 15908861) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is (4R,4aS,7S,7aR,12bS)-3-(cyclopropylmethyl)-7-(2-methylpropylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,7S,7aR,12bS)-3-(cyclopropylmethyl)-7-(2-methylpropylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 15908861 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | (4R,4aS,7S,7aR,12bS)-3-(cyclopropylmethyl)-7-(2-methylpropylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | CC(C)CN[C@H]1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C24H34N2O3/c1-14(2)12-25-17-7-8-24(28)19-11-16-5-6-18(27)21-20(16)23(24,22(17)29-21)9-10-26(19)13-15-3-4-15/h5-6,14-15,17,19,22,25,27-28H,3-4,7-13H2,1-2H3/t17-,19+,22-,23-,24+/m0/s1 |
| InChIKey | WPUDGQFXEGPIDD-YBAXTEPTSA-N |
| XLogP | 2.57 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |