C41H44N2O3 — CID 70267222
(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-7-[[2-(2,2-diphenylethyl)phenyl]methylamino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 70267222) has the molecular formula C41H44N2O3 and a molecular weight of 612.81 g/mol. Its IUPAC name is (4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-7-[[2-(2,2-diphenylethyl)phenyl]methylamino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-7-[[2-(2,2-diphenylethyl)phenyl]methylamino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 70267222 |
| Molecular Formula | C41H44N2O3 |
| Molecular Weight | 612.81 g/mol |
| Exact Mass | 612.34 |
| IUPAC Name | (4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-7-[[2-(2,2-diphenylethyl)phenyl]methylamino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | Oc1ccc2c3c1O[C@H]1[C@H](NCc4ccccc4CC(c4ccccc4)c4ccccc4)CC[C@@]4(O)[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C41H44N2O3/c44-35-18-17-31-24-36-41(45)20-19-34(39-40(41,37(31)38(35)46-39)21-22-43(36)26-27-15-16-27)42-25-32-14-8-7-13-30(32)23-33(28-9-3-1-4-10-28)29-11-5-2-6-12-29/h1-14,17-18,27,33-34,36,39,42,44-45H,15-16,19-26H2/t34-,36-,39+,40+,41-/m1/s1 |
| InChIKey | JFZDIGDMHZQMJX-YMEAJDOTSA-N |
| XLogP | 6.49 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.81 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |