C37H42N2O3 — CID 70217823
(E)-N-[(4R,4aS,12bS)-4a-hydroxy-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-3-phenylprop-2-enamide (PubChem CID 70217823) has the molecular formula C37H42N2O3 and a molecular weight of 562.75 g/mol. Its IUPAC name is (E)-N-[(4R,4aS,12bS)-4a-hydroxy-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(4R,4aS,12bS)-4a-hydroxy-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 70217823 |
| Molecular Formula | C37H42N2O3 |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | (E)-N-[(4R,4aS,12bS)-4a-hydroxy-3-(2-phenylethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-3-phenylprop-2-enamide |
| SMILES | CC(C)CN(C(=O)/C=C/c1ccccc1)C1CC[C@@]2(O)[C@H]3Cc4cccc5c4[C@@]2(CCN3CCc2ccccc2)C1O5 |
| InChI | InChI=1S/C37H42N2O3/c1-26(2)25-39(33(40)17-16-27-10-5-3-6-11-27)30-18-20-37(41)32-24-29-14-9-15-31-34(29)36(37,35(30)42-31)21-23-38(32)22-19-28-12-7-4-8-13-28/h3-17,26,30,32,35,41H,18-25H2,1-2H3/b17-16+/t30?,32-,35?,36+,37-/m1/s1 |
| InChIKey | YUTCNMZPYAGJFC-KEWRUZSASA-N |
| XLogP | 5.65 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|