C31H35F3N2O3 — CID 57067428
N-[(4R,4aS,12bS)-4a-hydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 57067428) has the molecular formula C31H35F3N2O3 and a molecular weight of 540.63 g/mol. Its IUPAC name is N-[(4R,4aS,12bS)-4a-hydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[(4R,4aS,12bS)-4a-hydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 57067428 |
| Molecular Formula | C31H35F3N2O3 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | N-[(4R,4aS,12bS)-4a-hydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-(2-methylpropyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CC(C)CN(C(=O)C=Cc1cccc(C(F)(F)F)c1)C1CC[C@@]2(O)[C@H]3Cc4cccc5c4[C@@]2(CCN3C)C1O5 |
| InChI | InChI=1S/C31H35F3N2O3/c1-19(2)18-36(26(37)11-10-20-6-4-8-22(16-20)31(32,33)34)23-12-13-30(38)25-17-21-7-5-9-24-27(21)29(30,28(23)39-24)14-15-35(25)3/h4-11,16,19,23,25,28,38H,12-15,17-18H2,1-3H3/t23?,25-,28?,29+,30-/m1/s1 |
| InChIKey | QFLFLNAMZDWUMD-PUNFRTFKSA-N |
| XLogP | 5.06 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|