C35H42N2O6 — CID 70217755
[(4R,4aS,12bS)-4a-acetyloxy-3-methyl-7-[[(E)-3-(3-methylphenyl)prop-2-enoyl]-(2-methylpropyl)amino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 70217755) has the molecular formula C35H42N2O6 and a molecular weight of 586.73 g/mol. Its IUPAC name is [(4R,4aS,12bS)-4a-acetyloxy-3-methyl-7-[[(E)-3-(3-methylphenyl)prop-2-enoyl]-(2-methylpropyl)amino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aS,12bS)-4a-acetyloxy-3-methyl-7-[[(E)-3-(3-methylphenyl)prop-2-enoyl]-(2-methylpropyl)amino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 70217755 |
| Molecular Formula | C35H42N2O6 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | [(4R,4aS,12bS)-4a-acetyloxy-3-methyl-7-[[(E)-3-(3-methylphenyl)prop-2-enoyl]-(2-methylpropyl)amino]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c3c1OC1C(N(CC(C)C)C(=O)/C=C/c4cccc(C)c4)CC[C@@]4(OC(C)=O)[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C35H42N2O6/c1-21(2)20-37(30(40)13-10-25-9-7-8-22(3)18-25)27-14-15-35(43-24(5)39)29-19-26-11-12-28(41-23(4)38)32-31(26)34(35,33(27)42-32)16-17-36(29)6/h7-13,18,21,27,29,33H,14-17,19-20H2,1-6H3/b13-10+/t27?,29-,33?,34+,35-/m1/s1 |
| InChIKey | UQGPAWPCNVBBHH-YZUCMODWSA-N |
| XLogP | 4.84 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|