C33H40N2O5 — CID 70221322
[(4R,4aR,7R,7aR,12bS)-9-methoxy-3-methyl-7-[2-methylpropyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate (PubChem CID 70221322) has the molecular formula C33H40N2O5 and a molecular weight of 544.69 g/mol. Its IUPAC name is [(4R,4aR,7R,7aR,12bS)-9-methoxy-3-methyl-7-[2-methylpropyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate.
| Compound Name | [(4R,4aR,7R,7aR,12bS)-9-methoxy-3-methyl-7-[2-methylpropyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
|---|---|
| PubChem CID | 70221322 |
| Molecular Formula | C33H40N2O5 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | [(4R,4aR,7R,7aR,12bS)-9-methoxy-3-methyl-7-[2-methylpropyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
| SMILES | COc1cc(OC(C)=O)c2c3c1O[C@H]1[C@H](N(CC(C)C)C(=O)C=Cc4ccccc4)CC[C@H]4[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C33H40N2O5/c1-20(2)19-35(29(37)14-11-22-9-7-6-8-10-22)25-13-12-24-26-17-23-27(39-21(3)36)18-28(38-5)31-30(23)33(24,32(25)40-31)15-16-34(26)4/h6-11,14,18,20,24-26,32H,12-13,15-17,19H2,1-5H3/t24-,25+,26+,32-,33-/m0/s1 |
| InChIKey | RJIOJYCMSZALJK-OSJXVIOSSA-N |
| XLogP | 4.86 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|