C35H42N2O4 — CID 70219591
[(4R,4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-7-[2-methylpropyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate (PubChem CID 70219591) has the molecular formula C35H42N2O4 and a molecular weight of 554.73 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-7-[2-methylpropyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-7-[2-methylpropyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
|---|---|
| PubChem CID | 70219591 |
| Molecular Formula | C35H42N2O4 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-7-[2-methylpropyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c3c1C[C@@H]1[C@@H]4CC[C@H](N(CC(C)C)C(=O)C=Cc5ccccc5)[C@H](O2)[C@]34CCN1CC1CC1 |
| InChI | InChI=1S/C35H42N2O4/c1-22(2)20-37(32(39)16-11-24-7-5-4-6-8-24)28-13-12-27-29-19-26-30(40-23(3)38)14-15-31-33(26)35(27,34(28)41-31)17-18-36(29)21-25-9-10-25/h4-8,11,14-16,22,25,27-29,34H,9-10,12-13,17-21H2,1-3H3/t27-,28-,29+,34-,35-/m0/s1 |
| InChIKey | KFQOJRRTDUUKAW-AAPWRWHYSA-N |
| XLogP | 5.63 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|