C39H44N2O4 — CID 57155273
[2-[(4R,4aR,7R,7aR,12bS)-7-[2-methylpropyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate (PubChem CID 57155273) has the molecular formula C39H44N2O4 and a molecular weight of 604.79 g/mol. Its IUPAC name is [2-[(4R,4aR,7R,7aR,12bS)-7-[2-methylpropyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate.
| Compound Name | [2-[(4R,4aR,7R,7aR,12bS)-7-[2-methylpropyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate |
|---|---|
| PubChem CID | 57155273 |
| Molecular Formula | C39H44N2O4 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | [2-[(4R,4aR,7R,7aR,12bS)-7-[2-methylpropyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate |
| SMILES | CC(=O)OC(CN1CC[C@]23c4c5cccc4O[C@H]2[C@H](N(CC(C)C)C(=O)C=Cc2ccccc2)CC[C@H]3[C@H]1C5)c1ccccc1 |
| InChI | InChI=1S/C39H44N2O4/c1-26(2)24-41(36(43)20-17-28-11-6-4-7-12-28)32-19-18-31-33-23-30-15-10-16-34-37(30)39(31,38(32)45-34)21-22-40(33)25-35(44-27(3)42)29-13-8-5-9-14-29/h4-17,20,26,31-33,35,38H,18-19,21-25H2,1-3H3/t31-,32+,33+,35?,38-,39-/m0/s1 |
| InChIKey | URGQBBLVOMAXFK-GUSIQKSVSA-N |
| XLogP | 6.60 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|