C35H38N2O6 — CID 57219107
[2-[(4R,4aR,7R,7aR,12bS)-7-[3-(furan-3-yl)prop-2-enoyl-methylamino]-9-methoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate (PubChem CID 57219107) has the molecular formula C35H38N2O6 and a molecular weight of 582.70 g/mol. Its IUPAC name is [2-[(4R,4aR,7R,7aR,12bS)-7-[3-(furan-3-yl)prop-2-enoyl-methylamino]-9-methoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate.
| Compound Name | [2-[(4R,4aR,7R,7aR,12bS)-7-[3-(furan-3-yl)prop-2-enoyl-methylamino]-9-methoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate |
|---|---|
| PubChem CID | 57219107 |
| Molecular Formula | C35H38N2O6 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | [2-[(4R,4aR,7R,7aR,12bS)-7-[3-(furan-3-yl)prop-2-enoyl-methylamino]-9-methoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate |
| SMILES | COc1ccc2c3c1O[C@H]1[C@H](N(C)C(=O)C=Cc4ccoc4)CC[C@H]4[C@@H](C2)N(CC(OC(C)=O)c2ccccc2)CC[C@@]341 |
| InChI | InChI=1S/C35H38N2O6/c1-22(38)42-30(24-7-5-4-6-8-24)20-37-17-16-35-26-11-12-27(36(2)31(39)14-9-23-15-18-41-21-23)34(35)43-33-29(40-3)13-10-25(32(33)35)19-28(26)37/h4-10,13-15,18,21,26-28,30,34H,11-12,16-17,19-20H2,1-3H3/t26-,27+,28+,30?,34-,35-/m0/s1 |
| InChIKey | LFLBNXXILYTDLY-YXQHMXNTSA-N |
| XLogP | 5.17 |
| TPSA | 81.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|