C36H38N2O5 — CID 57247163
[2-[(4R,4aR,7R,7aR,12bS)-9-hydroxy-7-[methyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate (PubChem CID 57247163) has the molecular formula C36H38N2O5 and a molecular weight of 578.71 g/mol. Its IUPAC name is [2-[(4R,4aR,7R,7aR,12bS)-9-hydroxy-7-[methyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate.
| Compound Name | [2-[(4R,4aR,7R,7aR,12bS)-9-hydroxy-7-[methyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate |
|---|---|
| PubChem CID | 57247163 |
| Molecular Formula | C36H38N2O5 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | [2-[(4R,4aR,7R,7aR,12bS)-9-hydroxy-7-[methyl(3-phenylprop-2-enoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate |
| SMILES | CC(=O)OC(CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@H](N(C)C(=O)C=Cc2ccccc2)CC[C@H]3[C@H]1C5)c1ccccc1 |
| InChI | InChI=1S/C36H38N2O5/c1-23(39)42-31(25-11-7-4-8-12-25)22-38-20-19-36-27-15-16-28(37(2)32(41)18-13-24-9-5-3-6-10-24)35(36)43-34-30(40)17-14-26(33(34)36)21-29(27)38/h3-14,17-18,27-29,31,35,40H,15-16,19-22H2,1-2H3/t27-,28+,29+,31?,35-,36-/m0/s1 |
| InChIKey | JEPHMHUJDCFHEH-ZJOAAECVSA-N |
| XLogP | 5.28 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|