C39H42N2O5 — CID 57217726
[2-[(4R,4aR,7S,7aR,12bS)-9-hydroxy-7-[2-methylpropyl(3-phenylprop-2-ynoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate (PubChem CID 57217726) has the molecular formula C39H42N2O5 and a molecular weight of 618.77 g/mol. Its IUPAC name is [2-[(4R,4aR,7S,7aR,12bS)-9-hydroxy-7-[2-methylpropyl(3-phenylprop-2-ynoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate.
| Compound Name | [2-[(4R,4aR,7S,7aR,12bS)-9-hydroxy-7-[2-methylpropyl(3-phenylprop-2-ynoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate |
|---|---|
| PubChem CID | 57217726 |
| Molecular Formula | C39H42N2O5 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | [2-[(4R,4aR,7S,7aR,12bS)-9-hydroxy-7-[2-methylpropyl(3-phenylprop-2-ynoyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]-1-phenylethyl] acetate |
| SMILES | CC(=O)OC(CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](N(CC(C)C)C(=O)C#Cc2ccccc2)CC[C@H]3[C@H]1C5)c1ccccc1 |
| InChI | InChI=1S/C39H42N2O5/c1-25(2)23-41(35(44)19-14-27-10-6-4-7-11-27)31-17-16-30-32-22-29-15-18-33(43)37-36(29)39(30,38(31)46-37)20-21-40(32)24-34(45-26(3)42)28-12-8-5-9-13-28/h4-13,15,18,25,30-32,34,38,43H,16-17,20-24H2,1-3H3/t30-,31-,32+,34?,38-,39-/m0/s1 |
| InChIKey | OHJZURGSMKGUMQ-LHBWVQISSA-N |
| XLogP | 5.64 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|