C34H38N2O5 — CID 57036578
[(4R,4aR,7S,7aR,12bS)-7-[2-methylpropyl(3-phenylprop-2-ynoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 57036578) has the molecular formula C34H38N2O5 and a molecular weight of 554.69 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-7-[2-methylpropyl(3-phenylprop-2-ynoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-7-[2-methylpropyl(3-phenylprop-2-ynoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 57036578 |
| Molecular Formula | C34H38N2O5 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-7-[2-methylpropyl(3-phenylprop-2-ynoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CC(=O)CN1CC[C@]23c4c5ccc(OC(C)=O)c4O[C@H]2[C@@H](N(CC(C)C)C(=O)C#Cc2ccccc2)CC[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C34H38N2O5/c1-21(2)19-36(30(39)15-10-24-8-6-5-7-9-24)27-13-12-26-28-18-25-11-14-29(40-23(4)38)32-31(25)34(26,33(27)41-32)16-17-35(28)20-22(3)37/h5-9,11,14,21,26-28,33H,12-13,16-20H2,1-4H3/t26-,27-,28+,33-,34-/m0/s1 |
| InChIKey | PQFOFRTYDOILDR-ZGDQGXFDSA-N |
| XLogP | 4.14 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|