C47H54N2O4 — CID 57153871
[(4R,4aR,7S,7aR,12bS)-7-[2,2-diphenylethyl(6-phenylhexyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 57153871) has the molecular formula C47H54N2O4 and a molecular weight of 710.96 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-7-[2,2-diphenylethyl(6-phenylhexyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-7-[2,2-diphenylethyl(6-phenylhexyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 57153871 |
| Molecular Formula | C47H54N2O4 |
| Molecular Weight | 710.96 g/mol |
| Exact Mass | 710.41 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-7-[2,2-diphenylethyl(6-phenylhexyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CC(=O)CN1CC[C@]23c4c5ccc(OC(C)=O)c4O[C@H]2[C@@H](N(CCCCCCc2ccccc2)CC(c2ccccc2)c2ccccc2)CC[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C47H54N2O4/c1-33(50)31-49-29-27-47-40-24-25-41(46(47)53-45-43(52-34(2)51)26-23-38(44(45)47)30-42(40)49)48(28-15-4-3-8-16-35-17-9-5-10-18-35)32-39(36-19-11-6-12-20-36)37-21-13-7-14-22-37/h5-7,9-14,17-23,26,39-42,46H,3-4,8,15-16,24-25,27-32H2,1-2H3/t40-,41-,42+,46-,47-/m0/s1 |
| InChIKey | LQAPFGDXSHMKTI-FPQAEGFKSA-N |
| XLogP | 8.55 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.96 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|