C39H52N2O5 — CID 57298636
[(4R,4aR,7R,7aR,12bS)-7-[butyl(8-phenyloctanoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 57298636) has the molecular formula C39H52N2O5 and a molecular weight of 628.85 g/mol. Its IUPAC name is [(4R,4aR,7R,7aR,12bS)-7-[butyl(8-phenyloctanoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aR,7R,7aR,12bS)-7-[butyl(8-phenyloctanoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 57298636 |
| Molecular Formula | C39H52N2O5 |
| Molecular Weight | 628.85 g/mol |
| Exact Mass | 628.39 |
| IUPAC Name | [(4R,4aR,7R,7aR,12bS)-7-[butyl(8-phenyloctanoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CCCCN(C(=O)CCCCCCCc1ccccc1)[C@@H]1CC[C@H]2[C@H]3Cc4ccc(OC(C)=O)c5c4[C@@]2(CCN3CC(C)=O)[C@H]1O5 |
| InChI | InChI=1S/C39H52N2O5/c1-4-5-23-41(35(44)17-13-8-6-7-10-14-29-15-11-9-12-16-29)32-20-19-31-33-25-30-18-21-34(45-28(3)43)37-36(30)39(31,38(32)46-37)22-24-40(33)26-27(2)42/h9,11-12,15-16,18,21,31-33,38H,4-8,10,13-14,17,19-20,22-26H2,1-3H3/t31-,32+,33+,38-,39-/m0/s1 |
| InChIKey | ADNFLMHKIMVQTN-QGIUIPRWSA-N |
| XLogP | 6.82 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.85 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|