C37H50N2O4 — CID 56990106
N-[(4R,4aR,7S,7aR,12bS)-3-[(2-hydroxycyclopropyl)methyl]-9-methoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-butyl-6-phenylhexanamide (PubChem CID 56990106) has the molecular formula C37H50N2O4 and a molecular weight of 586.82 g/mol. Its IUPAC name is N-[(4R,4aR,7S,7aR,12bS)-3-[(2-hydroxycyclopropyl)methyl]-9-methoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-butyl-6-phenylhexanamide.
| Compound Name | N-[(4R,4aR,7S,7aR,12bS)-3-[(2-hydroxycyclopropyl)methyl]-9-methoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-butyl-6-phenylhexanamide |
|---|---|
| PubChem CID | 56990106 |
| Molecular Formula | C37H50N2O4 |
| Molecular Weight | 586.82 g/mol |
| Exact Mass | 586.38 |
| IUPAC Name | N-[(4R,4aR,7S,7aR,12bS)-3-[(2-hydroxycyclopropyl)methyl]-9-methoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-butyl-6-phenylhexanamide |
| SMILES | CCCCN(C(=O)CCCCCc1ccccc1)[C@H]1CC[C@H]2[C@H]3Cc4ccc(OC)c5c4[C@@]2(CCN3CC2CC2O)[C@H]1O5 |
| InChI | InChI=1S/C37H50N2O4/c1-3-4-20-39(33(41)14-10-6-9-13-25-11-7-5-8-12-25)29-17-16-28-30-22-26-15-18-32(42-2)35-34(26)37(28,36(29)43-35)19-21-38(30)24-27-23-31(27)40/h5,7-8,11-12,15,18,27-31,36,40H,3-4,6,9-10,13-14,16-17,19-24H2,1-2H3/t27?,28-,29-,30+,31?,36-,37-/m0/s1 |
| InChIKey | NLGOPTRHBJSNFU-UYDXDDAUSA-N |
| XLogP | 5.92 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.82 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|