C40H52N2O5 — CID 57279559
[(4R,4aR,7R,7aR,12bS)-7-[cyclohexylmethyl(6-phenylhexanoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 57279559) has the molecular formula C40H52N2O5 and a molecular weight of 640.87 g/mol. Its IUPAC name is [(4R,4aR,7R,7aR,12bS)-7-[cyclohexylmethyl(6-phenylhexanoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aR,7R,7aR,12bS)-7-[cyclohexylmethyl(6-phenylhexanoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 57279559 |
| Molecular Formula | C40H52N2O5 |
| Molecular Weight | 640.87 g/mol |
| Exact Mass | 640.39 |
| IUPAC Name | [(4R,4aR,7R,7aR,12bS)-7-[cyclohexylmethyl(6-phenylhexanoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CC(=O)CN1CC[C@]23c4c5ccc(OC(C)=O)c4O[C@H]2[C@H](N(CC2CCCCC2)C(=O)CCCCCc2ccccc2)CC[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C40H52N2O5/c1-27(43)25-41-23-22-40-32-19-20-33(39(40)47-38-35(46-28(2)44)21-18-31(37(38)40)24-34(32)41)42(26-30-15-9-4-10-16-30)36(45)17-11-5-8-14-29-12-6-3-7-13-29/h3,6-7,12-13,18,21,30,32-34,39H,4-5,8-11,14-17,19-20,22-26H2,1-2H3/t32-,33+,34+,39-,40-/m0/s1 |
| InChIKey | HLLJRNHSXPJDIZ-ZICRLCMLSA-N |
| XLogP | 6.82 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.87 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|