C36H52N2O5 — CID 57311673
[(4R,4aR,7R,7aR,12bS)-7-[butyl(5-cyclohexylpentanoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 57311673) has the molecular formula C36H52N2O5 and a molecular weight of 592.82 g/mol. Its IUPAC name is [(4R,4aR,7R,7aR,12bS)-7-[butyl(5-cyclohexylpentanoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aR,7R,7aR,12bS)-7-[butyl(5-cyclohexylpentanoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 57311673 |
| Molecular Formula | C36H52N2O5 |
| Molecular Weight | 592.82 g/mol |
| Exact Mass | 592.39 |
| IUPAC Name | [(4R,4aR,7R,7aR,12bS)-7-[butyl(5-cyclohexylpentanoyl)amino]-3-(2-oxopropyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CCCCN(C(=O)CCCCC1CCCCC1)[C@@H]1CC[C@H]2[C@H]3Cc4ccc(OC(C)=O)c5c4[C@@]2(CCN3CC(C)=O)[C@H]1O5 |
| InChI | InChI=1S/C36H52N2O5/c1-4-5-20-38(32(41)14-10-9-13-26-11-7-6-8-12-26)29-17-16-28-30-22-27-15-18-31(42-25(3)40)34-33(27)36(28,35(29)43-34)19-21-37(30)23-24(2)39/h15,18,26,28-30,35H,4-14,16-17,19-23H2,1-3H3/t28-,29+,30+,35-,36-/m0/s1 |
| InChIKey | PWQVFBFMCVQROD-YEAHYAFESA-N |
| XLogP | 6.38 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.82 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|