C35H50N2O5 — CID 18393616
[(4R,4aR,7S,7aR,12bS)-7-[5-cyclohexylpentanoyl(ethyl)amino]-3-(cyclopropylmethyl)-11-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 18393616) has the molecular formula C35H50N2O5 and a molecular weight of 578.79 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-7-[5-cyclohexylpentanoyl(ethyl)amino]-3-(cyclopropylmethyl)-11-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-7-[5-cyclohexylpentanoyl(ethyl)amino]-3-(cyclopropylmethyl)-11-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 18393616 |
| Molecular Formula | C35H50N2O5 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.37 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-7-[5-cyclohexylpentanoyl(ethyl)amino]-3-(cyclopropylmethyl)-11-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CCN(C(=O)CCCCC1CCCCC1)[C@H]1CC[C@H]2[C@H]3Cc4c(O)cc(OC(C)=O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C35H50N2O5/c1-3-37(31(40)12-8-7-11-23-9-5-4-6-10-23)27-16-15-26-28-19-25-29(39)20-30(41-22(2)38)33-32(25)35(26,34(27)42-33)17-18-36(28)21-24-13-14-24/h20,23-24,26-28,34,39H,3-19,21H2,1-2H3/t26-,27-,28+,34-,35-/m0/s1 |
| InChIKey | UWFSQKMEZLILSP-RAGANDHCSA-N |
| XLogP | 6.12 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|