C33H48N2O4 — CID 18393558
N-[(4R,4aR,7R,7aR,12bS)-11-hydroxy-9-methoxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-cyclohexyl-N-ethylpentanamide (PubChem CID 18393558) has the molecular formula C33H48N2O4 and a molecular weight of 536.76 g/mol. Its IUPAC name is N-[(4R,4aR,7R,7aR,12bS)-11-hydroxy-9-methoxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-cyclohexyl-N-ethylpentanamide.
| Compound Name | N-[(4R,4aR,7R,7aR,12bS)-11-hydroxy-9-methoxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-cyclohexyl-N-ethylpentanamide |
|---|---|
| PubChem CID | 18393558 |
| Molecular Formula | C33H48N2O4 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.36 |
| IUPAC Name | N-[(4R,4aR,7R,7aR,12bS)-11-hydroxy-9-methoxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-cyclohexyl-N-ethylpentanamide |
| SMILES | C=CCN1CC[C@]23c4c5c(O)cc(OC)c4O[C@H]2[C@H](N(CC)C(=O)CCCCC2CCCCC2)CC[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C33H48N2O4/c1-4-18-34-19-17-33-24-15-16-25(35(5-2)29(37)14-10-9-13-22-11-7-6-8-12-22)32(33)39-31-28(38-3)21-27(36)23(30(31)33)20-26(24)34/h4,21-22,24-26,32,36H,1,5-20H2,2-3H3/t24-,25+,26+,32-,33-/m0/s1 |
| InChIKey | HQQFQDSZSOMOER-OSJXVIOSSA-N |
| XLogP | 5.98 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|