C35H46N2O4 — CID 18393574
N-[(4R,4aR,7R,7aR,12bS)-11-hydroxy-9-methoxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-8-phenyloctanamide (PubChem CID 18393574) has the molecular formula C35H46N2O4 and a molecular weight of 558.76 g/mol. Its IUPAC name is N-[(4R,4aR,7R,7aR,12bS)-11-hydroxy-9-methoxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-8-phenyloctanamide.
| Compound Name | N-[(4R,4aR,7R,7aR,12bS)-11-hydroxy-9-methoxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-8-phenyloctanamide |
|---|---|
| PubChem CID | 18393574 |
| Molecular Formula | C35H46N2O4 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.35 |
| IUPAC Name | N-[(4R,4aR,7R,7aR,12bS)-11-hydroxy-9-methoxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-8-phenyloctanamide |
| SMILES | C=CCN1CC[C@]23c4c5c(O)cc(OC)c4O[C@H]2[C@H](N(C)C(=O)CCCCCCCc2ccccc2)CC[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C35H46N2O4/c1-4-20-37-21-19-35-26-17-18-27(34(35)41-33-30(40-3)23-29(38)25(32(33)35)22-28(26)37)36(2)31(39)16-12-7-5-6-9-13-24-14-10-8-11-15-24/h4,8,10-11,14-15,23,26-28,34,38H,1,5-7,9,12-13,16-22H2,2-3H3/t26-,27+,28+,34-,35-/m0/s1 |
| InChIKey | RGXLAQLUNNTGIS-BNAYZRNVSA-N |
| XLogP | 6.04 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|