C36H48N2O4 — CID 18393738
N-[(4R,4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-11-hydroxy-9-methoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-8-phenyloctanamide (PubChem CID 18393738) has the molecular formula C36H48N2O4 and a molecular weight of 572.79 g/mol. Its IUPAC name is N-[(4R,4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-11-hydroxy-9-methoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-8-phenyloctanamide.
| Compound Name | N-[(4R,4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-11-hydroxy-9-methoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-8-phenyloctanamide |
|---|---|
| PubChem CID | 18393738 |
| Molecular Formula | C36H48N2O4 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.36 |
| IUPAC Name | N-[(4R,4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-11-hydroxy-9-methoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-8-phenyloctanamide |
| SMILES | COc1cc(O)c2c3c1O[C@H]1[C@@H](N(C)C(=O)CCCCCCCc4ccccc4)CC[C@H]4[C@@H](C2)N(CC2CC2)CC[C@@]341 |
| InChI | InChI=1S/C36H48N2O4/c1-37(32(40)14-10-5-3-4-7-11-24-12-8-6-9-13-24)28-18-17-27-29-21-26-30(39)22-31(41-2)34-33(26)36(27,35(28)42-34)19-20-38(29)23-25-15-16-25/h6,8-9,12-13,22,25,27-29,35,39H,3-5,7,10-11,14-21,23H2,1-2H3/t27-,28-,29+,35-,36-/m0/s1 |
| InChIKey | LRBMQFBOWRBUAO-ADWRAXPNSA-N |
| XLogP | 6.26 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|