C37H52N2O3 — CID 70267493
(4R,4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-9-methoxy-7-[2-methylpropyl(6-phenylhexyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-ol (PubChem CID 70267493) has the molecular formula C37H52N2O3 and a molecular weight of 572.83 g/mol. Its IUPAC name is (4R,4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-9-methoxy-7-[2-methylpropyl(6-phenylhexyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-ol.
| Compound Name | (4R,4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-9-methoxy-7-[2-methylpropyl(6-phenylhexyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-ol |
|---|---|
| PubChem CID | 70267493 |
| Molecular Formula | C37H52N2O3 |
| Molecular Weight | 572.83 g/mol |
| Exact Mass | 572.40 |
| IUPAC Name | (4R,4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-9-methoxy-7-[2-methylpropyl(6-phenylhexyl)amino]-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-ol |
| SMILES | COc1cc(O)c2c3c1O[C@H]1[C@@H](N(CCCCCCc4ccccc4)CC(C)C)CC[C@H]4[C@@H](C2)N(CC2CC2)CC[C@@]341 |
| InChI | InChI=1S/C37H52N2O3/c1-25(2)23-38(19-10-5-4-7-11-26-12-8-6-9-13-26)30-17-16-29-31-21-28-32(40)22-33(41-3)35-34(28)37(29,36(30)42-35)18-20-39(31)24-27-14-15-27/h6,8-9,12-13,22,25,27,29-31,36,40H,4-5,7,10-11,14-21,23-24H2,1-3H3/t29-,30-,31+,36-,37-/m0/s1 |
| InChIKey | MXDRFHYJXPULDP-RQTCIDQWSA-N |
| XLogP | 6.98 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.83 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|