C35H38N2O3 — CID 57213595
N-[(4R,4aR,7R,7aR,12bS)-9-hydroxy-3-(2-phenylethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-(3-methylphenyl)prop-2-enamide (PubChem CID 57213595) has the molecular formula C35H38N2O3 and a molecular weight of 534.70 g/mol. Its IUPAC name is N-[(4R,4aR,7R,7aR,12bS)-9-hydroxy-3-(2-phenylethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-(3-methylphenyl)prop-2-enamide.
| Compound Name | N-[(4R,4aR,7R,7aR,12bS)-9-hydroxy-3-(2-phenylethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 57213595 |
| Molecular Formula | C35H38N2O3 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | N-[(4R,4aR,7R,7aR,12bS)-9-hydroxy-3-(2-phenylethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-N-methyl-3-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(C=CC(=O)N(C)[C@@H]2CC[C@H]3[C@H]4Cc5ccc(O)c6c5[C@@]3(CCN4CCc3ccccc3)[C@H]2O6)c1 |
| InChI | InChI=1S/C35H38N2O3/c1-23-7-6-10-25(21-23)11-16-31(39)36(2)28-14-13-27-29-22-26-12-15-30(38)33-32(26)35(27,34(28)40-33)18-20-37(29)19-17-24-8-4-3-5-9-24/h3-12,15-16,21,27-29,34,38H,13-14,17-20,22H2,1-2H3/t27-,28+,29+,34-,35-/m0/s1 |
| InChIKey | ZCBXMDGLCUNGBQ-PLQDATLTSA-N |
| XLogP | 5.52 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|